C14H27N7O7 — CID 18485452
2-[[2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 18485452) has the molecular formula C14H27N7O7 and a molecular weight of 405.41 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18485452 |
| Molecular Formula | C14H27N7O7 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | NCC(=O)NC(CCCN=C(N)N)C(=O)NC(CO)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C14H27N7O7/c15-4-10(24)19-7(2-1-3-18-14(16)17)11(25)20-8(5-22)12(26)21-9(6-23)13(27)28/h7-9,22-23H,1-6,15H2,(H,19,24)(H,20,25)(H,21,26)(H,27,28)(H4,16,17,18) |
| InChIKey | TXQFXDXLJRUJOG-UHFFFAOYSA-N |
| XLogP | -5.48 |
| TPSA | 255.48 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | -5.48 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|