C16H29N7O8 — CID 18486769
4-[(2-aminoacetyl)amino]-5-[[1-[(1-carboxy-2-hydroxyethyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 18486769) has the molecular formula C16H29N7O8 and a molecular weight of 447.45 g/mol. Its IUPAC name is 4-[(2-aminoacetyl)amino]-5-[[1-[(1-carboxy-2-hydroxyethyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[(2-aminoacetyl)amino]-5-[[1-[(1-carboxy-2-hydroxyethyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18486769 |
| Molecular Formula | C16H29N7O8 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 4-[(2-aminoacetyl)amino]-5-[[1-[(1-carboxy-2-hydroxyethyl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | NCC(=O)NC(CCC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C16H29N7O8/c17-6-11(25)21-9(3-4-12(26)27)14(29)22-8(2-1-5-20-16(18)19)13(28)23-10(7-24)15(30)31/h8-10,24H,1-7,17H2,(H,21,25)(H,22,29)(H,23,28)(H,26,27)(H,30,31)(H4,18,19,20) |
| InChIKey | SYBARCYVYMNTCW-UHFFFAOYSA-N |
| XLogP | -4.61 |
| TPSA | 272.55 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | -4.61 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|