C17H29N7O9 — CID 18486757
2-[[2-[[2-[(2-aminoacetyl)amino]-4-carboxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid (PubChem CID 18486757) has the molecular formula C17H29N7O9 and a molecular weight of 475.46 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-aminoacetyl)amino]-4-carboxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-4-carboxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18486757 |
| Molecular Formula | C17H29N7O9 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-4-carboxybutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]butanedioic acid |
| SMILES | NCC(=O)NC(CCC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H29N7O9/c18-7-11(25)22-9(3-4-12(26)27)15(31)23-8(2-1-5-21-17(19)20)14(30)24-10(16(32)33)6-13(28)29/h8-10H,1-7,18H2,(H,22,25)(H,23,31)(H,24,30)(H,26,27)(H,28,29)(H,32,33)(H4,19,20,21) |
| InChIKey | NPLJJIDBVMSORD-UHFFFAOYSA-N |
| XLogP | -4.12 |
| TPSA | 289.62 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|