C15H27N7O7 — CID 18487544
2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid (PubChem CID 18487544) has the molecular formula C15H27N7O7 and a molecular weight of 417.42 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18487544 |
| Molecular Formula | C15H27N7O7 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]pentanedioic acid |
| SMILES | NCC(=O)NCC(=O)NC(CCCN=C(N)N)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H27N7O7/c16-6-10(23)20-7-11(24)21-8(2-1-5-19-15(17)18)13(27)22-9(14(28)29)3-4-12(25)26/h8-9H,1-7,16H2,(H,20,23)(H,21,24)(H,22,27)(H,25,26)(H,28,29)(H4,17,18,19) |
| InChIKey | PFUJQBBWNOQDDD-UHFFFAOYSA-N |
| XLogP | -3.97 |
| TPSA | 252.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | -3.97 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|