C14H22N4O9 — CID 18487621
2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-4-carboxybutanoyl]amino]pentanedioic acid (PubChem CID 18487621) has the molecular formula C14H22N4O9 and a molecular weight of 390.35 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-4-carboxybutanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-4-carboxybutanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18487621 |
| Molecular Formula | C14H22N4O9 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-4-carboxybutanoyl]amino]pentanedioic acid |
| SMILES | NCC(=O)NCC(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H22N4O9/c15-5-9(19)16-6-10(20)17-7(1-3-11(21)22)13(25)18-8(14(26)27)2-4-12(23)24/h7-8H,1-6,15H2,(H,16,19)(H,17,20)(H,18,25)(H,21,22)(H,23,24)(H,26,27) |
| InChIKey | SGJLSUSFCSNDNY-UHFFFAOYSA-N |
| XLogP | -3.15 |
| TPSA | 225.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |