C19H38N10O5 — CID 18492254
2-[[2-[[2-[(2-aminoacetyl)amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18492254) has the molecular formula C19H38N10O5 and a molecular weight of 486.58 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-aminoacetyl)amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18492254 |
| Molecular Formula | C19H38N10O5 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(C)C(NC(=O)CN)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C19H38N10O5/c1-10(2)14(29-13(30)9-20)16(32)27-11(5-3-7-25-18(21)22)15(31)28-12(17(33)34)6-4-8-26-19(23)24/h10-12,14H,3-9,20H2,1-2H3,(H,27,32)(H,28,31)(H,29,30)(H,33,34)(H4,21,22,25)(H4,23,24,26) |
| InChIKey | FAJNPYQKXQSENB-UHFFFAOYSA-N |
| XLogP | -3.75 |
| TPSA | 279.42 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | -3.75 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|