C18H33N7O7 — CID 18492334
4-[[2-[(2-aminoacetyl)amino]-3-methylbutanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid (PubChem CID 18492334) has the molecular formula C18H33N7O7 and a molecular weight of 459.50 g/mol. Its IUPAC name is 4-[[2-[(2-aminoacetyl)amino]-3-methylbutanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-[(2-aminoacetyl)amino]-3-methylbutanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18492334 |
| Molecular Formula | C18H33N7O7 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 4-[[2-[(2-aminoacetyl)amino]-3-methylbutanoyl]amino]-5-[[1-carboxy-4-(diaminomethylideneamino)butyl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)C(NC(=O)CN)C(=O)NC(CCC(=O)O)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C18H33N7O7/c1-9(2)14(25-12(26)8-19)16(30)23-10(5-6-13(27)28)15(29)24-11(17(31)32)4-3-7-22-18(20)21/h9-11,14H,3-8,19H2,1-2H3,(H,23,30)(H,24,29)(H,25,26)(H,27,28)(H,31,32)(H4,20,21,22) |
| InChIKey | AYNCVRWUMWXKML-UHFFFAOYSA-N |
| XLogP | -2.94 |
| TPSA | 252.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|