C22H35N7O6 — CID 18492591
2-[[2-[[2-[(2-aminoacetyl)amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18492591) has the molecular formula C22H35N7O6 and a molecular weight of 493.57 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-aminoacetyl)amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18492591 |
| Molecular Formula | C22H35N7O6 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(C)C(NC(=O)CN)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C22H35N7O6/c1-12(2)18(29-17(31)11-23)20(33)28-16(10-13-5-7-14(30)8-6-13)19(32)27-15(21(34)35)4-3-9-26-22(24)25/h5-8,12,15-16,18,30H,3-4,9-11,23H2,1-2H3,(H,27,32)(H,28,33)(H,29,31)(H,34,35)(H4,24,25,26) |
| InChIKey | XHMHDTRDVUXYLB-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|