C20H31N7O7 — CID 18485455
2-[[2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 18485455) has the molecular formula C20H31N7O7 and a molecular weight of 481.51 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 18485455 |
| Molecular Formula | C20H31N7O7 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | NCC(=O)NC(CCCN=C(N)N)C(=O)NC(CO)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C20H31N7O7/c21-9-16(30)25-13(2-1-7-24-20(22)23)17(31)27-15(10-28)18(32)26-14(19(33)34)8-11-3-5-12(29)6-4-11/h3-6,13-15,28-29H,1-2,7-10,21H2,(H,25,30)(H,26,32)(H,27,31)(H,33,34)(H4,22,23,24) |
| InChIKey | ZQPDPBHVIPCYSZ-UHFFFAOYSA-N |
| XLogP | -3.52 |
| TPSA | 255.48 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|