C23H38N8O6 — CID 18492054
2-[[6-amino-2-[[2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18492054) has the molecular formula C23H38N8O6 and a molecular weight of 522.61 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18492054 |
| Molecular Formula | C23H38N8O6 |
| Molecular Weight | 522.61 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1ccc(O)cc1)NC(=O)CN)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C23H38N8O6/c24-10-2-1-4-16(20(34)31-17(22(36)37)5-3-11-28-23(26)27)30-21(35)18(29-19(33)13-25)12-14-6-8-15(32)9-7-14/h6-9,16-18,32H,1-5,10-13,24-25H2,(H,29,33)(H,30,35)(H,31,34)(H,36,37)(H4,26,27,28) |
| InChIKey | VESQWDDTHBCEKF-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 261.27 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.61 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|