C17H26CuN6O4 — CID 67333832
2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid;copper (PubChem CID 67333832) has the molecular formula C17H26CuN6O4 and a molecular weight of 441.98 g/mol. Its IUPAC name is 2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid;copper.
| Compound Name | 2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid;copper |
|---|---|
| PubChem CID | 67333832 |
| Molecular Formula | C17H26CuN6O4 |
| Molecular Weight | 441.98 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoic acid;copper |
| SMILES | NCC(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(=O)O.[Cu] |
| InChI | InChI=1S/C17H26N6O4.Cu/c18-10-14(24)22-12(7-4-8-21-17(19)20)15(25)23-13(16(26)27)9-11-5-2-1-3-6-11;/h1-3,5-6,12-13H,4,7-10,18H2,(H,22,24)(H,23,25)(H,26,27)(H4,19,20,21); |
| InChIKey | UVWDVISLINGOAS-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 185.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.98 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|