C21H31N7O7 — CID 18485400
2-[[2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]butanedioic acid (PubChem CID 18485400) has the molecular formula C21H31N7O7 and a molecular weight of 493.52 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18485400 |
| Molecular Formula | C21H31N7O7 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | 2-[[2-[[2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-phenylpropanoyl]amino]butanedioic acid |
| SMILES | NCC(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H31N7O7/c22-11-16(29)26-13(7-4-8-25-21(23)24)18(32)27-14(9-12-5-2-1-3-6-12)19(33)28-15(20(34)35)10-17(30)31/h1-3,5-6,13-15H,4,7-11,22H2,(H,26,29)(H,27,32)(H,28,33)(H,30,31)(H,34,35)(H4,23,24,25) |
| InChIKey | FPYKEHMUOWTSJY-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 252.32 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|