C13H26N4O4S — CID 51037326
(2S)-6-amino-2-[[(2S)-2-[(2-aminoacetyl)amino]-4-methylsulfanylbutanoyl]amino]hexanoic acid (PubChem CID 51037326) has the molecular formula C13H26N4O4S and a molecular weight of 334.44 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[(2-aminoacetyl)amino]-4-methylsulfanylbutanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[(2-aminoacetyl)amino]-4-methylsulfanylbutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 51037326 |
| Molecular Formula | C13H26N4O4S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[(2-aminoacetyl)amino]-4-methylsulfanylbutanoyl]amino]hexanoic acid |
| SMILES | CSCC[C@H](NC(=O)CN)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C13H26N4O4S/c1-22-7-5-9(16-11(18)8-15)12(19)17-10(13(20)21)4-2-3-6-14/h9-10H,2-8,14-15H2,1H3,(H,16,18)(H,17,19)(H,20,21)/t9-,10-/m0/s1 |
| InChIKey | ZWRDOVYMQAAISL-UWVGGRQHSA-N |
| XLogP | -1.12 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|