C16H32N4O4S2 — CID 18222899
2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 18222899) has the molecular formula C16H32N4O4S2 and a molecular weight of 408.59 g/mol. Its IUPAC name is 2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 18222899 |
| Molecular Formula | C16H32N4O4S2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(N)C(=O)NC(CCCCN)C(=O)NC(CCSC)C(=O)O |
| InChI | InChI=1S/C16H32N4O4S2/c1-25-9-6-11(18)14(21)19-12(5-3-4-8-17)15(22)20-13(16(23)24)7-10-26-2/h11-13H,3-10,17-18H2,1-2H3,(H,19,21)(H,20,22)(H,23,24) |
| InChIKey | VBGGTAPDGFQMKF-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|