C14H28N4O4S2 — CID 145456898
(2S)-6-amino-2-[[(2R)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid (PubChem CID 145456898) has the molecular formula C14H28N4O4S2 and a molecular weight of 380.54 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2R)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2R)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 145456898 |
| Molecular Formula | C14H28N4O4S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | (2S)-6-amino-2-[[(2R)-2-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid |
| SMILES | CSCC[C@H](N)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C14H28N4O4S2/c1-24-7-5-9(16)12(19)18-11(8-23)13(20)17-10(14(21)22)4-2-3-6-15/h9-11,23H,2-8,15-16H2,1H3,(H,17,20)(H,18,19)(H,21,22)/t9-,10-,11-/m0/s1 |
| InChIKey | IZLCDZDNZFEDHB-DCAQKATOSA-N |
| XLogP | -0.82 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|