C17H33N5O6S2 — CID 19998223
2-[[2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-3-hydroxypropanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 19998223) has the molecular formula C17H33N5O6S2 and a molecular weight of 467.61 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-3-hydroxypropanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-3-hydroxypropanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 19998223 |
| Molecular Formula | C17H33N5O6S2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-3-hydroxypropanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CSCCC(N)C(=O)NC(CCCCN)C(=O)NC(CO)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C17H33N5O6S2/c1-30-7-5-10(19)14(24)20-11(4-2-3-6-18)15(25)21-12(8-23)16(26)22-13(9-29)17(27)28/h10-13,23,29H,2-9,18-19H2,1H3,(H,20,24)(H,21,25)(H,22,26)(H,27,28) |
| InChIKey | ZIJNQFQTZGIRDS-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|