C14H28N4O5S — CID 18222902
2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 18222902) has the molecular formula C14H28N4O5S and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18222902 |
| Molecular Formula | C14H28N4O5S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CSCCC(N)C(=O)NC(CCCCN)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C14H28N4O5S/c1-24-7-5-9(16)12(20)17-10(4-2-3-6-15)13(21)18-11(8-19)14(22)23/h9-11,19H,2-8,15-16H2,1H3,(H,17,20)(H,18,21)(H,22,23) |
| InChIKey | CGUYGMFQZCYJSG-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|