C20H39N5O5S2 — CID 19997213
6-amino-2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid (PubChem CID 19997213) has the molecular formula C20H39N5O5S2 and a molecular weight of 493.70 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 19997213 |
| Molecular Formula | C20H39N5O5S2 |
| Molecular Weight | 493.70 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CCSC)C(=O)NC(CS)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C20H39N5O5S2/c1-4-12(2)16(25-17(26)13(22)8-10-32-3)19(28)24-15(11-31)18(27)23-14(20(29)30)7-5-6-9-21/h12-16,31H,4-11,21-22H2,1-3H3,(H,23,27)(H,24,28)(H,25,26)(H,29,30) |
| InChIKey | LTAFBBCLWGGQBU-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.70 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|