C14H27N3O4S2 — CID 18222853
2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18222853) has the molecular formula C14H27N3O4S2 and a molecular weight of 365.52 g/mol. Its IUPAC name is 2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18222853 |
| Molecular Formula | C14H27N3O4S2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-methylpentanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CCSC)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C14H27N3O4S2/c1-4-8(2)11(13(19)16-10(7-22)14(20)21)17-12(18)9(15)5-6-23-3/h8-11,22H,4-7,15H2,1-3H3,(H,16,19)(H,17,18)(H,20,21) |
| InChIKey | ZEVPMOHYCQFWSE-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|