C13H25N3O4S2 — CID 18223046
2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-methylbutanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18223046) has the molecular formula C13H25N3O4S2 and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-methylbutanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-methylbutanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18223046 |
| Molecular Formula | C13H25N3O4S2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-methylbutanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CSCCC(N)C(=O)NC(C(=O)NC(CS)C(=O)O)C(C)C |
| InChI | InChI=1S/C13H25N3O4S2/c1-7(2)10(12(18)15-9(6-21)13(19)20)16-11(17)8(14)4-5-22-3/h7-10,21H,4-6,14H2,1-3H3,(H,15,18)(H,16,17)(H,19,20) |
| InChIKey | MFDDVIJCQYOOES-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|