C21H39N5O7S — CID 19998103
2-[[2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]butanedioic acid (PubChem CID 19998103) has the molecular formula C21H39N5O7S and a molecular weight of 505.64 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 19998103 |
| Molecular Formula | C21H39N5O7S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-4-methylsulfanylbutanoyl)amino]hexanoyl]amino]-3-methylpentanoyl]amino]butanedioic acid |
| SMILES | CCC(C)C(NC(=O)C(CCCCN)NC(=O)C(N)CCSC)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H39N5O7S/c1-4-12(2)17(20(31)25-15(21(32)33)11-16(27)28)26-19(30)14(7-5-6-9-22)24-18(29)13(23)8-10-34-3/h12-15,17H,4-11,22-23H2,1-3H3,(H,24,29)(H,25,31)(H,26,30)(H,27,28)(H,32,33) |
| InChIKey | SKQBVTUOAIABAQ-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 213.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|