C19H37N5O5S3 — CID 18259524
6-amino-2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoyl]amino]hexanoic acid (PubChem CID 18259524) has the molecular formula C19H37N5O5S3 and a molecular weight of 511.74 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18259524 |
| Molecular Formula | C19H37N5O5S3 |
| Molecular Weight | 511.74 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoyl]amino]hexanoic acid |
| SMILES | CSCCC(NC(=O)C(N)CS)C(=O)NC(CCSC)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C19H37N5O5S3/c1-31-9-6-13(22-16(25)12(21)11-30)17(26)23-14(7-10-32-2)18(27)24-15(19(28)29)5-3-4-8-20/h12-15,30H,3-11,20-21H2,1-2H3,(H,22,25)(H,23,26)(H,24,27)(H,28,29) |
| InChIKey | CUYYEEWVKGUMQM-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.74 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|