C18H34N6O6S2 — CID 18255515
2-[[6-amino-2-[[4-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]-4-oxobutanoyl]amino]hexanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 18255515) has the molecular formula C18H34N6O6S2 and a molecular weight of 494.64 g/mol. Its IUPAC name is 2-[[6-amino-2-[[4-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]-4-oxobutanoyl]amino]hexanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[6-amino-2-[[4-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]-4-oxobutanoyl]amino]hexanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 18255515 |
| Molecular Formula | C18H34N6O6S2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 2-[[6-amino-2-[[4-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]-4-oxobutanoyl]amino]hexanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C(CCCCN)NC(=O)C(CC(N)=O)NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C18H34N6O6S2/c1-32-7-5-12(18(29)30)23-16(27)11(4-2-3-6-19)22-17(28)13(8-14(21)25)24-15(26)10(20)9-31/h10-13,31H,2-9,19-20H2,1H3,(H2,21,25)(H,22,28)(H,23,27)(H,24,26)(H,29,30) |
| InChIKey | STBNGQHKXIECPV-UHFFFAOYSA-N |
| XLogP | -2.46 |
| TPSA | 219.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|