C17H33N5O5S2 — CID 18254736
6-amino-2-[[2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]-4-methylsulfanylbutanoyl]amino]hexanoic acid (PubChem CID 18254736) has the molecular formula C17H33N5O5S2 and a molecular weight of 451.62 g/mol. Its IUPAC name is 6-amino-2-[[2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]-4-methylsulfanylbutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]-4-methylsulfanylbutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18254736 |
| Molecular Formula | C17H33N5O5S2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | 6-amino-2-[[2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]-4-methylsulfanylbutanoyl]amino]hexanoic acid |
| SMILES | CSCCC(NC(=O)C(C)NC(=O)C(N)CS)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C17H33N5O5S2/c1-10(20-15(24)11(19)9-28)14(23)21-12(6-8-29-2)16(25)22-13(17(26)27)5-3-4-7-18/h10-13,28H,3-9,18-19H2,1-2H3,(H,20,24)(H,21,23)(H,22,25)(H,26,27) |
| InChIKey | DZNLDEODGUDOTJ-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|