C20H40N6O5S2 — CID 18259125
6-amino-2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-4-methylsulfanylbutanoyl]amino]hexanoic acid (PubChem CID 18259125) has the molecular formula C20H40N6O5S2 and a molecular weight of 508.71 g/mol. Its IUPAC name is 6-amino-2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-4-methylsulfanylbutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-4-methylsulfanylbutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18259125 |
| Molecular Formula | C20H40N6O5S2 |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 6-amino-2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-4-methylsulfanylbutanoyl]amino]hexanoic acid |
| SMILES | CSCCC(NC(=O)C(CCCCN)NC(=O)C(N)CS)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C20H40N6O5S2/c1-33-11-8-15(19(29)26-16(20(30)31)7-3-5-10-22)25-18(28)14(6-2-4-9-21)24-17(27)13(23)12-32/h13-16,32H,2-12,21-23H2,1H3,(H,24,27)(H,25,28)(H,26,29)(H,30,31) |
| InChIKey | JZJFZETWYMIACD-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 202.66 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|