C19H36N6O6S2 — CID 18259499
5-amino-2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-4-methylsulfanylbutanoyl]amino]hexanoyl]amino]-5-oxopentanoic acid (PubChem CID 18259499) has the molecular formula C19H36N6O6S2 and a molecular weight of 508.67 g/mol. Its IUPAC name is 5-amino-2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-4-methylsulfanylbutanoyl]amino]hexanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-4-methylsulfanylbutanoyl]amino]hexanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18259499 |
| Molecular Formula | C19H36N6O6S2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 5-amino-2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-4-methylsulfanylbutanoyl]amino]hexanoyl]amino]-5-oxopentanoic acid |
| SMILES | CSCCC(NC(=O)C(N)CS)C(=O)NC(CCCCN)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C19H36N6O6S2/c1-33-9-7-13(23-16(27)11(21)10-32)18(29)24-12(4-2-3-8-20)17(28)25-14(19(30)31)5-6-15(22)26/h11-14,32H,2-10,20-21H2,1H3,(H2,22,26)(H,23,27)(H,24,29)(H,25,28)(H,30,31) |
| InChIKey | JEAUWTTXDGJUCV-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 219.73 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|