C16H31N5O5S — CID 145456641
(2S)-2-[[(2S)-5-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]-5-oxopentanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 145456641) has the molecular formula C16H31N5O5S and a molecular weight of 405.52 g/mol. Its IUPAC name is (2S)-2-[[(2S)-5-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]-5-oxopentanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-5-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]-5-oxopentanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 145456641 |
| Molecular Formula | C16H31N5O5S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | (2S)-2-[[(2S)-5-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]-5-oxopentanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)[C@H](CCC(N)=O)NC(=O)[C@@H](N)CCCCN)C(=O)O |
| InChI | InChI=1S/C16H31N5O5S/c1-27-9-7-12(16(25)26)21-15(24)11(5-6-13(19)22)20-14(23)10(18)4-2-3-8-17/h10-12H,2-9,17-18H2,1H3,(H2,19,22)(H,20,23)(H,21,24)(H,25,26)/t10-,11-,12-/m0/s1 |
| InChIKey | CKSBRMUOQDNPKZ-SRVKXCTJSA-N |
| XLogP | -1.48 |
| TPSA | 190.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|