C12H24N4O4S — CID 18219754
6-amino-2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]hexanoic acid (PubChem CID 18219754) has the molecular formula C12H24N4O4S and a molecular weight of 320.42 g/mol. Its IUPAC name is 6-amino-2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]hexanoic acid.
| Compound Name | 6-amino-2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 18219754 |
| Molecular Formula | C12H24N4O4S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 6-amino-2-[2-[(2-amino-3-sulfanylpropanoyl)amino]propanoylamino]hexanoic acid |
| SMILES | CC(NC(=O)C(N)CS)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C12H24N4O4S/c1-7(15-11(18)8(14)6-21)10(17)16-9(12(19)20)4-2-3-5-13/h7-9,21H,2-6,13-14H2,1H3,(H,15,18)(H,16,17)(H,19,20) |
| InChIKey | DCJNIJAWIRPPBB-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|