C14H27N5O5S — CID 18257292
6-amino-2-[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]acetyl]amino]propanoylamino]hexanoic acid (PubChem CID 18257292) has the molecular formula C14H27N5O5S and a molecular weight of 377.47 g/mol. Its IUPAC name is 6-amino-2-[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]acetyl]amino]propanoylamino]hexanoic acid.
| Compound Name | 6-amino-2-[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]acetyl]amino]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 18257292 |
| Molecular Formula | C14H27N5O5S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 6-amino-2-[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]acetyl]amino]propanoylamino]hexanoic acid |
| SMILES | CC(NC(=O)CNC(=O)C(N)CS)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C14H27N5O5S/c1-8(18-11(20)6-17-13(22)9(16)7-25)12(21)19-10(14(23)24)4-2-3-5-15/h8-10,25H,2-7,15-16H2,1H3,(H,17,22)(H,18,20)(H,19,21)(H,23,24) |
| InChIKey | CVLBTEWYMPNNFE-UHFFFAOYSA-N |
| XLogP | -2.44 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|