C12H24N4O4S2 — CID 18219834
6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-sulfanylpropanoyl]amino]hexanoic acid (PubChem CID 18219834) has the molecular formula C12H24N4O4S2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-sulfanylpropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-sulfanylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18219834 |
| Molecular Formula | C12H24N4O4S2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-sulfanylpropanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CS)NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C12H24N4O4S2/c13-4-2-1-3-8(12(19)20)15-11(18)9(6-22)16-10(17)7(14)5-21/h7-9,21-22H,1-6,13-14H2,(H,15,18)(H,16,17)(H,19,20) |
| InChIKey | LWTTURISBKEVAC-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|