C15H31N5O4S — CID 18222521
2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18222521) has the molecular formula C15H31N5O4S and a molecular weight of 377.51 g/mol. Its IUPAC name is 2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18222521 |
| Molecular Formula | C15H31N5O4S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCCCN)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C15H31N5O4S/c16-7-3-1-5-10(18)13(21)19-11(6-2-4-8-17)14(22)20-12(9-25)15(23)24/h10-12,25H,1-9,16-18H2,(H,19,21)(H,20,22)(H,23,24) |
| InChIKey | AHFOKDZWPPGJAZ-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 173.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|