C13H25N5O5S — CID 18222400
4-amino-2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-4-oxobutanoic acid (PubChem CID 18222400) has the molecular formula C13H25N5O5S and a molecular weight of 363.44 g/mol. Its IUPAC name is 4-amino-2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18222400 |
| Molecular Formula | C13H25N5O5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 4-amino-2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-4-oxobutanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CS)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C13H25N5O5S/c14-4-2-1-3-7(15)11(20)18-9(6-24)12(21)17-8(13(22)23)5-10(16)19/h7-9,24H,1-6,14-15H2,(H2,16,19)(H,17,21)(H,18,20)(H,22,23) |
| InChIKey | XTONYTDATVADQH-UHFFFAOYSA-N |
| XLogP | -2.70 |
| TPSA | 190.63 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|