C14H25N5O7 — CID 145456592
(2S)-2-[[(2S)-4-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]-4-oxobutanoyl]amino]butanedioic acid (PubChem CID 145456592) has the molecular formula C14H25N5O7 and a molecular weight of 375.38 g/mol. Its IUPAC name is (2S)-2-[[(2S)-4-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]-4-oxobutanoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(2S)-4-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]-4-oxobutanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 145456592 |
| Molecular Formula | C14H25N5O7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (2S)-2-[[(2S)-4-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]-4-oxobutanoyl]amino]butanedioic acid |
| SMILES | NCCCC[C@H](N)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H25N5O7/c15-4-2-1-3-7(16)12(23)18-8(5-10(17)20)13(24)19-9(14(25)26)6-11(21)22/h7-9H,1-6,15-16H2,(H2,17,20)(H,18,23)(H,19,24)(H,21,22)(H,25,26)/t7-,8-,9-/m0/s1 |
| InChIKey | BYPMOIFBQPEWOH-CIUDSAMLSA-N |
| XLogP | -3.15 |
| TPSA | 227.93 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|