C19H33N7O9 — CID 18304730
2-[[4-amino-2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]butanedioic acid (PubChem CID 18304730) has the molecular formula C19H33N7O9 and a molecular weight of 503.51 g/mol. Its IUPAC name is 2-[[4-amino-2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]butanedioic acid.
| Compound Name | 2-[[4-amino-2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18304730 |
| Molecular Formula | C19H33N7O9 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | 2-[[4-amino-2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]butanedioic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCC(N)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H33N7O9/c20-6-2-1-3-9(21)16(31)24-10(4-5-13(22)27)17(32)25-11(7-14(23)28)18(33)26-12(19(34)35)8-15(29)30/h9-12H,1-8,20-21H2,(H2,22,27)(H2,23,28)(H,24,31)(H,25,32)(H,26,33)(H,29,30)(H,34,35) |
| InChIKey | LBDIKQLPDWLNDS-UHFFFAOYSA-N |
| XLogP | -4.40 |
| TPSA | 300.12 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | -4.40 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|