C20H34N6O10 — CID 18263363
6-amino-2-[[2-[[4-amino-2-[(2-amino-4-carboxybutanoyl)amino]-4-oxobutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid (PubChem CID 18263363) has the molecular formula C20H34N6O10 and a molecular weight of 518.52 g/mol. Its IUPAC name is 6-amino-2-[[2-[[4-amino-2-[(2-amino-4-carboxybutanoyl)amino]-4-oxobutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[4-amino-2-[(2-amino-4-carboxybutanoyl)amino]-4-oxobutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18263363 |
| Molecular Formula | C20H34N6O10 |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | 6-amino-2-[[2-[[4-amino-2-[(2-amino-4-carboxybutanoyl)amino]-4-oxobutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CCC(=O)O)NC(=O)C(CC(N)=O)NC(=O)C(N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H34N6O10/c21-8-2-1-3-12(20(35)36)25-18(33)11(5-7-16(30)31)24-19(34)13(9-14(23)27)26-17(32)10(22)4-6-15(28)29/h10-13H,1-9,21-22H2,(H2,23,27)(H,24,34)(H,25,33)(H,26,32)(H,28,29)(H,30,31)(H,35,36) |
| InChIKey | UKHHQBAZXFMSCY-UHFFFAOYSA-N |
| XLogP | -3.41 |
| TPSA | 294.33 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|