C21H39N7O8 — CID 22656579
6-amino-2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid (PubChem CID 22656579) has the molecular formula C21H39N7O8 and a molecular weight of 517.58 g/mol. Its IUPAC name is 6-amino-2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22656579 |
| Molecular Formula | C21H39N7O8 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | 6-amino-2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CCC(=O)O)NC(=O)C(CCCCN)NC(=O)C(N)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C21H39N7O8/c22-9-3-1-5-13(26-18(32)12(24)11-16(25)29)19(33)27-14(7-8-17(30)31)20(34)28-15(21(35)36)6-2-4-10-23/h12-15H,1-11,22-24H2,(H2,25,29)(H,26,32)(H,27,33)(H,28,34)(H,30,31)(H,35,36) |
| InChIKey | XMIWLJZCISMBTP-UHFFFAOYSA-N |
| XLogP | -3.15 |
| TPSA | 283.05 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|