C18H30N6O10 — CID 22653346
6-amino-2-[[3-carboxy-2-[[3-carboxy-2-[(2,4-diamino-4-oxobutanoyl)amino]propanoyl]amino]propanoyl]amino]hexanoic acid (PubChem CID 22653346) has the molecular formula C18H30N6O10 and a molecular weight of 490.47 g/mol. Its IUPAC name is 6-amino-2-[[3-carboxy-2-[[3-carboxy-2-[(2,4-diamino-4-oxobutanoyl)amino]propanoyl]amino]propanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[3-carboxy-2-[[3-carboxy-2-[(2,4-diamino-4-oxobutanoyl)amino]propanoyl]amino]propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22653346 |
| Molecular Formula | C18H30N6O10 |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | 6-amino-2-[[3-carboxy-2-[[3-carboxy-2-[(2,4-diamino-4-oxobutanoyl)amino]propanoyl]amino]propanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CC(=O)O)NC(=O)C(CC(=O)O)NC(=O)C(N)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C18H30N6O10/c19-4-2-1-3-9(18(33)34)22-16(31)11(7-14(28)29)24-17(32)10(6-13(26)27)23-15(30)8(20)5-12(21)25/h8-11H,1-7,19-20H2,(H2,21,25)(H,22,31)(H,23,30)(H,24,32)(H,26,27)(H,28,29)(H,33,34) |
| InChIKey | YYDOIFCNKQGDOX-UHFFFAOYSA-N |
| XLogP | -4.19 |
| TPSA | 294.33 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | -4.19 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|