C20H35N7O9 — CID 18304732
2-[[4-amino-2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]pentanedioic acid (PubChem CID 18304732) has the molecular formula C20H35N7O9 and a molecular weight of 517.54 g/mol. Its IUPAC name is 2-[[4-amino-2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[4-amino-2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18304732 |
| Molecular Formula | C20H35N7O9 |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | 2-[[4-amino-2-[[5-amino-2-(2,6-diaminohexanoylamino)-5-oxopentanoyl]amino]-4-oxobutanoyl]amino]pentanedioic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCC(N)=O)C(=O)NC(CC(N)=O)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H35N7O9/c21-8-2-1-3-10(22)17(32)25-11(4-6-14(23)28)18(33)27-13(9-15(24)29)19(34)26-12(20(35)36)5-7-16(30)31/h10-13H,1-9,21-22H2,(H2,23,28)(H2,24,29)(H,25,32)(H,26,34)(H,27,33)(H,30,31)(H,35,36) |
| InChIKey | ORFIWQHENMOYDL-UHFFFAOYSA-N |
| XLogP | -4.01 |
| TPSA | 300.12 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | -4.01 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|