C19H34N6O9 — CID 22654404
6-amino-2-[[2-[[4-carboxy-2-[(2,4-diamino-4-oxobutanoyl)amino]butanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid (PubChem CID 22654404) has the molecular formula C19H34N6O9 and a molecular weight of 490.51 g/mol. Its IUPAC name is 6-amino-2-[[2-[[4-carboxy-2-[(2,4-diamino-4-oxobutanoyl)amino]butanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[4-carboxy-2-[(2,4-diamino-4-oxobutanoyl)amino]butanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22654404 |
| Molecular Formula | C19H34N6O9 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 6-amino-2-[[2-[[4-carboxy-2-[(2,4-diamino-4-oxobutanoyl)amino]butanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid |
| SMILES | CC(O)C(NC(=O)C(CCC(=O)O)NC(=O)C(N)CC(N)=O)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C19H34N6O9/c1-9(26)15(18(32)24-12(19(33)34)4-2-3-7-20)25-17(31)11(5-6-14(28)29)23-16(30)10(21)8-13(22)27/h9-12,15,26H,2-8,20-21H2,1H3,(H2,22,27)(H,23,30)(H,24,32)(H,25,31)(H,28,29)(H,33,34) |
| InChIKey | JJTWXWBUMUTGPS-UHFFFAOYSA-N |
| XLogP | -3.90 |
| TPSA | 277.26 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | -3.90 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|