C19H33N5O10 — CID 18253000
6-amino-2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-hydroxybutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid (PubChem CID 18253000) has the molecular formula C19H33N5O10 and a molecular weight of 491.50 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-hydroxybutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-hydroxybutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18253000 |
| Molecular Formula | C19H33N5O10 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-hydroxybutanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
| SMILES | CC(O)C(NC(=O)C(N)CC(=O)O)C(=O)NC(CCC(=O)O)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C19H33N5O10/c1-9(25)15(24-16(30)10(21)8-14(28)29)18(32)22-11(5-6-13(26)27)17(31)23-12(19(33)34)4-2-3-7-20/h9-12,15,25H,2-8,20-21H2,1H3,(H,22,32)(H,23,31)(H,24,30)(H,26,27)(H,28,29)(H,33,34) |
| InChIKey | SHLIZIKZDXEIKQ-UHFFFAOYSA-N |
| XLogP | -3.30 |
| TPSA | 271.47 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|