C18H33N5O8 — CID 18234899
6-amino-2-[[2-[[2-(2-aminopropanoylamino)-4-carboxybutanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid (PubChem CID 18234899) has the molecular formula C18H33N5O8 and a molecular weight of 447.49 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-(2-aminopropanoylamino)-4-carboxybutanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-(2-aminopropanoylamino)-4-carboxybutanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18234899 |
| Molecular Formula | C18H33N5O8 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 6-amino-2-[[2-[[2-(2-aminopropanoylamino)-4-carboxybutanoyl]amino]-3-hydroxybutanoyl]amino]hexanoic acid |
| SMILES | CC(N)C(=O)NC(CCC(=O)O)C(=O)NC(C(=O)NC(CCCCN)C(=O)O)C(C)O |
| InChI | InChI=1S/C18H33N5O8/c1-9(20)15(27)21-11(6-7-13(25)26)16(28)23-14(10(2)24)17(29)22-12(18(30)31)5-3-4-8-19/h9-12,14,24H,3-8,19-20H2,1-2H3,(H,21,27)(H,22,29)(H,23,28)(H,25,26)(H,30,31) |
| InChIKey | VZKAZVDAHOYFBN-UHFFFAOYSA-N |
| XLogP | -2.75 |
| TPSA | 234.17 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|