C20H37N5O7 — CID 18236265
6-amino-2-[[2-[[2-(2-aminopropanoylamino)-3-methylpentanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid (PubChem CID 18236265) has the molecular formula C20H37N5O7 and a molecular weight of 459.54 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-(2-aminopropanoylamino)-3-methylpentanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-(2-aminopropanoylamino)-3-methylpentanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18236265 |
| Molecular Formula | C20H37N5O7 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | 6-amino-2-[[2-[[2-(2-aminopropanoylamino)-3-methylpentanoyl]amino]-4-carboxybutanoyl]amino]hexanoic acid |
| SMILES | CCC(C)C(NC(=O)C(C)N)C(=O)NC(CCC(=O)O)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C20H37N5O7/c1-4-11(2)16(25-17(28)12(3)22)19(30)23-13(8-9-15(26)27)18(29)24-14(20(31)32)7-5-6-10-21/h11-14,16H,4-10,21-22H2,1-3H3,(H,23,30)(H,24,29)(H,25,28)(H,26,27)(H,31,32) |
| InChIKey | DBECJTCHMMCPDF-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 213.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|