C18H35N5O5 — CID 18237120
2-[[2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-3-methylpentanoyl]amino]propanoic acid (PubChem CID 18237120) has the molecular formula C18H35N5O5 and a molecular weight of 401.51 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-3-methylpentanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-3-methylpentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18237120 |
| Molecular Formula | C18H35N5O5 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.26 |
| IUPAC Name | 2-[[2-[[6-amino-2-(2-aminopropanoylamino)hexanoyl]amino]-3-methylpentanoyl]amino]propanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCCCN)NC(=O)C(C)N)C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C18H35N5O5/c1-5-10(2)14(17(26)21-12(4)18(27)28)23-16(25)13(8-6-7-9-19)22-15(24)11(3)20/h10-14H,5-9,19-20H2,1-4H3,(H,21,26)(H,22,24)(H,23,25)(H,27,28) |
| InChIKey | VROVJIIONHZXRP-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|