C20H38N6O6 — CID 18305990
2-[[5-amino-2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]-5-oxopentanoyl]amino]propanoic acid (PubChem CID 18305990) has the molecular formula C20H38N6O6 and a molecular weight of 458.56 g/mol. Its IUPAC name is 2-[[5-amino-2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]-5-oxopentanoyl]amino]propanoic acid.
| Compound Name | 2-[[5-amino-2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]-5-oxopentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18305990 |
| Molecular Formula | C20H38N6O6 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | 2-[[5-amino-2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]-5-oxopentanoyl]amino]propanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CCCCN)C(=O)NC(CCC(N)=O)C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C20H38N6O6/c1-4-11(2)16(26-17(28)13(22)7-5-6-10-21)19(30)25-14(8-9-15(23)27)18(29)24-12(3)20(31)32/h11-14,16H,4-10,21-22H2,1-3H3,(H2,23,27)(H,24,29)(H,25,30)(H,26,28)(H,31,32) |
| InChIKey | JYTAIPYKNWKFRL-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 219.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|