C21H42N6O5 — CID 18306836
2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-3-methylpentanoyl]amino]propanoic acid (PubChem CID 18306836) has the molecular formula C21H42N6O5 and a molecular weight of 458.60 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-3-methylpentanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-3-methylpentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18306836 |
| Molecular Formula | C21H42N6O5 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.32 |
| IUPAC Name | 2-[[2-[[6-amino-2-(2,6-diaminohexanoylamino)hexanoyl]amino]-3-methylpentanoyl]amino]propanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCCCN)NC(=O)C(N)CCCCN)C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C21H42N6O5/c1-4-13(2)17(20(30)25-14(3)21(31)32)27-19(29)16(10-6-8-12-23)26-18(28)15(24)9-5-7-11-22/h13-17H,4-12,22-24H2,1-3H3,(H,25,30)(H,26,28)(H,27,29)(H,31,32) |
| InChIKey | NLSDMEJBJBDRRJ-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 202.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|