C19H35N5O7 — CID 18302508
2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-methylpentanoyl]amino]butanedioic acid (PubChem CID 18302508) has the molecular formula C19H35N5O7 and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-methylpentanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-methylpentanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18302508 |
| Molecular Formula | C19H35N5O7 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 2-[[2-[2-(2,6-diaminohexanoylamino)propanoylamino]-3-methylpentanoyl]amino]butanedioic acid |
| SMILES | CCC(C)C(NC(=O)C(C)NC(=O)C(N)CCCCN)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H35N5O7/c1-4-10(2)15(18(29)23-13(19(30)31)9-14(25)26)24-16(27)11(3)22-17(28)12(21)7-5-6-8-20/h10-13,15H,4-9,20-21H2,1-3H3,(H,22,28)(H,23,29)(H,24,27)(H,25,26)(H,30,31) |
| InChIKey | YPSXYXBFGADNLU-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 213.94 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|