C18H35N5O6 — CID 18305886
2-[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]propanoylamino]-3-hydroxypropanoic acid (PubChem CID 18305886) has the molecular formula C18H35N5O6 and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]propanoylamino]-3-hydroxypropanoic acid.
| Compound Name | 2-[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]propanoylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18305886 |
| Molecular Formula | C18H35N5O6 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | 2-[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]propanoylamino]-3-hydroxypropanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CCCCN)C(=O)NC(C)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C18H35N5O6/c1-4-10(2)14(23-16(26)12(20)7-5-6-8-19)17(27)21-11(3)15(25)22-13(9-24)18(28)29/h10-14,24H,4-9,19-20H2,1-3H3,(H,21,27)(H,22,25)(H,23,26)(H,28,29) |
| InChIKey | SORKMNLKWOWLAX-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|