C18H35N5O5S — CID 18304078
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-methylpentanoyl]amino]propanoic acid (PubChem CID 18304078) has the molecular formula C18H35N5O5S and a molecular weight of 433.58 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-methylpentanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-methylpentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18304078 |
| Molecular Formula | C18H35N5O5S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-methylpentanoyl]amino]propanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CS)NC(=O)C(N)CCCCN)C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C18H35N5O5S/c1-4-10(2)14(17(26)21-11(3)18(27)28)23-16(25)13(9-29)22-15(24)12(20)7-5-6-8-19/h10-14,29H,4-9,19-20H2,1-3H3,(H,21,26)(H,22,24)(H,23,25)(H,27,28) |
| InChIKey | WOPDCQXYKOUZRS-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|