C15H30N4O5 — CID 51002408
(2S)-2-[[(2S,3S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylpentanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 51002408) has the molecular formula C15H30N4O5 and a molecular weight of 346.43 g/mol. Its IUPAC name is (2S)-2-[[(2S,3S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylpentanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | (2S)-2-[[(2S,3S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylpentanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 51002408 |
| Molecular Formula | C15H30N4O5 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | (2S)-2-[[(2S,3S)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-methylpentanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H](N)CCCCN)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C15H30N4O5/c1-3-9(2)12(14(22)18-11(8-20)15(23)24)19-13(21)10(17)6-4-5-7-16/h9-12,20H,3-8,16-17H2,1-2H3,(H,18,22)(H,19,21)(H,23,24)/t9-,10-,11-,12-/m0/s1 |
| InChIKey | PRSBSVAVOQOAMI-BJDJZHNGSA-N |
| XLogP | -1.46 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|