C19H37N5O7 — CID 18306202
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoic acid (PubChem CID 18306202) has the molecular formula C19H37N5O7 and a molecular weight of 447.53 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 18306202 |
| Molecular Formula | C19H37N5O7 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-methylpentanoyl]amino]-3-hydroxybutanoyl]amino]-3-hydroxypropanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CCCCN)C(=O)NC(C(=O)NC(CO)C(=O)O)C(C)O |
| InChI | InChI=1S/C19H37N5O7/c1-4-10(2)14(23-16(27)12(21)7-5-6-8-20)17(28)24-15(11(3)26)18(29)22-13(9-25)19(30)31/h10-15,25-26H,4-9,20-21H2,1-3H3,(H,22,29)(H,23,27)(H,24,28)(H,30,31) |
| InChIKey | VGCGNBJLELTDGP-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 217.10 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|